C10H16N6O3 — CID 135465380
2-amino-9-[2-(2-aminoethoxy)ethoxymethyl]-1H-purin-6-one (PubChem CID 135465380) has the molecular formula C10H16N6O3 and a molecular weight of 268.28 g/mol. Its IUPAC name is 2-amino-9-[2-(2-aminoethoxy)ethoxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-(2-aminoethoxy)ethoxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135465380 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-amino-9-[2-(2-aminoethoxy)ethoxymethyl]-1H-purin-6-one |
| SMILES | NCCOCCOCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H16N6O3/c11-1-2-18-3-4-19-6-16-5-13-7-8(16)14-10(12)15-9(7)17/h5H,1-4,6,11H2,(H3,12,14,15,17) |
| InChIKey | PJEHCXHQVMNJLT-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|