C11H14N5O5- — CID 135763277
2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;prop-2-enoate (PubChem CID 135763277) has the molecular formula C11H14N5O5- and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;prop-2-enoate.
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;prop-2-enoate |
|---|---|
| PubChem CID | 135763277 |
| Molecular Formula | C11H14N5O5- |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;prop-2-enoate |
| SMILES | C=CC(=O)[O-].Nc1nc2c(ncn2COCCO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N5O3.C3H4O2/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14;1-2-3(4)5/h3,14H,1-2,4H2,(H3,9,11,12,15);2H,1H2,(H,4,5)/p-1 |
| InChIKey | DZFCLXGXKOFOHV-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|