C8H9ClN4O3 — CID 135675129
2-chloro-9-(2-hydroxyethoxymethyl)-1H-purin-6-one (PubChem CID 135675129) has the molecular formula C8H9ClN4O3 and a molecular weight of 244.64 g/mol. Its IUPAC name is 2-chloro-9-(2-hydroxyethoxymethyl)-1H-purin-6-one.
| Compound Name | 2-chloro-9-(2-hydroxyethoxymethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135675129 |
| Molecular Formula | C8H9ClN4O3 |
| Molecular Weight | 244.64 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-chloro-9-(2-hydroxyethoxymethyl)-1H-purin-6-one |
| SMILES | O=c1[nH]c(Cl)nc2c1ncn2COCCO |
| InChI | InChI=1S/C8H9ClN4O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H,11,12,15) |
| InChIKey | RWCYGLJSLQIGDH-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.64 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|