C10H12ClN5O3 — CID 156597245
N-[9-(2-chloroethoxymethyl)-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 156597245) has the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. Its IUPAC name is N-[9-(2-chloroethoxymethyl)-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-(2-chloroethoxymethyl)-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 156597245 |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[9-(2-chloroethoxymethyl)-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(ncn2COCCCl)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12ClN5O3/c1-6(17)13-10-14-8-7(9(18)15-10)12-4-16(8)5-19-3-2-11/h4H,2-3,5H2,1H3,(H2,13,14,15,17,18) |
| InChIKey | PQJANJYUJCCHNE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|