C14H19N5O4 — CID 136805600
N-[6-oxo-9-[2-(oxolan-2-yl)ethoxymethyl]-1H-purin-2-yl]acetamide (PubChem CID 136805600) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[6-oxo-9-[2-(oxolan-2-yl)ethoxymethyl]-1H-purin-2-yl]acetamide.
| Compound Name | N-[6-oxo-9-[2-(oxolan-2-yl)ethoxymethyl]-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 136805600 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-[6-oxo-9-[2-(oxolan-2-yl)ethoxymethyl]-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(ncn2COCCC2CCCO2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N5O4/c1-9(20)16-14-17-12-11(13(21)18-14)15-7-19(12)8-22-6-4-10-3-2-5-23-10/h7,10H,2-6,8H2,1H3,(H2,16,17,18,20,21) |
| InChIKey | OWPGULOFTJMAQO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|