C18H21N5O9 — CID 136914117
[(3R,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-9-yl)-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 136914117) has the molecular formula C18H21N5O9 and a molecular weight of 451.39 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-9-yl)-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-9-yl)-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 136914117 |
| Molecular Formula | C18H21N5O9 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | [(3R,4R,5R,6R)-6-(2-acetamido-6-oxo-1H-purin-9-yl)-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | CC(=O)Nc1nc2c(ncn2[C@@H]2OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N5O9/c1-7(24)20-18-21-15-12(16(28)22-18)19-6-23(15)17-14(32-10(4)27)13(31-9(3)26)11(5-29-17)30-8(2)25/h6,11,13-14,17H,5H2,1-4H3,(H2,20,21,22,24,28)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | YJIWIHRIWPSQDP-LSCFUAHRSA-N |
| XLogP | -0.60 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|