C24H34N6O9 — CID 147221152
[(2R,3S,4S,5R)-5-[2-(6-acetamidohexylamino)-6-oxo-1H-purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate (PubChem CID 147221152) has the molecular formula C24H34N6O9 and a molecular weight of 550.57 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-[2-(6-acetamidohexylamino)-6-oxo-1H-purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-5-[2-(6-acetamidohexylamino)-6-oxo-1H-purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 147221152 |
| Molecular Formula | C24H34N6O9 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(2R,3S,4S,5R)-5-[2-(6-acetamidohexylamino)-6-oxo-1H-purin-9-yl]-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)NCCCCCCNc1nc2c(ncn2[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C24H34N6O9/c1-13(31)25-9-7-5-6-8-10-26-24-28-21-18(22(35)29-24)27-12-30(21)23-20(38-16(4)34)19(37-15(3)33)17(39-23)11-36-14(2)32/h12,17,19-20,23H,5-11H2,1-4H3,(H,25,31)(H2,26,28,29,35)/t17-,19+,20+,23-/m1/s1 |
| InChIKey | CHBZNXDMKASONO-XDTJVVMOSA-N |
| XLogP | 0.55 |
| TPSA | 192.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|