C22H29N5O9 — CID 135503475
[5-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate (PubChem CID 135503475) has the molecular formula C22H29N5O9 and a molecular weight of 507.50 g/mol. Its IUPAC name is [5-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate.
| Compound Name | [5-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 135503475 |
| Molecular Formula | C22H29N5O9 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | [5-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)Nc1nc2c(ncn2C2OC(COC(=O)CC)C(OC(=O)CC)C2OC(=O)CC)c(=O)[nH]1 |
| InChI | InChI=1S/C22H29N5O9/c1-5-12(28)24-22-25-19-16(20(32)26-22)23-10-27(19)21-18(36-15(31)8-4)17(35-14(30)7-3)11(34-21)9-33-13(29)6-2/h10-11,17-18,21H,5-9H2,1-4H3,(H2,24,25,26,28,32) |
| InChIKey | SQABWJHXQJNZQR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|