C16H22N5O8P — CID 135858847
[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphite (PubChem CID 135858847) has the molecular formula C16H22N5O8P and a molecular weight of 443.35 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphite.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 135858847 |
| Molecular Formula | C16H22N5O8P |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[6-oxo-2-(propanoylamino)-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphite |
| SMILES | CCC(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](COP(O)O)[C@H]3OC(C)(C)O[C@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C16H22N5O8P/c1-4-8(22)18-15-19-12-9(13(23)20-15)17-6-21(12)14-11-10(28-16(2,3)29-11)7(27-14)5-26-30(24)25/h6-7,10-11,14,24-25H,4-5H2,1-3H3,(H2,18,19,20,22,23)/t7-,10-,11-,14-/m1/s1 |
| InChIKey | JRNKCIOVEMNMDZ-FRJWGUMJSA-N |
| XLogP | 0.11 |
| TPSA | 170.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|