C19H29N5O4 — CID 161050402
9-[(4R,6R,6aS)-2,2-dimethyl-6-propan-2-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-(2-methylpropylamino)-1H-purin-6-one (PubChem CID 161050402) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 9-[(4R,6R,6aS)-2,2-dimethyl-6-propan-2-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-(2-methylpropylamino)-1H-purin-6-one.
| Compound Name | 9-[(4R,6R,6aS)-2,2-dimethyl-6-propan-2-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 161050402 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 9-[(4R,6R,6aS)-2,2-dimethyl-6-propan-2-yl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-(2-methylpropylamino)-1H-purin-6-one |
| SMILES | CC(C)CNc1nc2c(ncn2[C@@H]2O[C@H](C(C)C)[C@@H]3OC(C)(C)OC32)c(=O)[nH]1 |
| InChI | InChI=1S/C19H29N5O4/c1-9(2)7-20-18-22-15-11(16(25)23-18)21-8-24(15)17-14-13(12(26-17)10(3)4)27-19(5,6)28-14/h8-10,12-14,17H,7H2,1-6H3,(H2,20,22,23,25)/t12-,13+,14?,17-/m1/s1 |
| InChIKey | ZJGAZOONCYWBBG-DVJFUJMWSA-N |
| XLogP | 2.26 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |