C14H19N4O11P2+ — CID 136634944
[2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-(6-oxo-2-phosphono-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-oxoethyl]-trihydroxyphosphanium (PubChem CID 136634944) has the molecular formula C14H19N4O11P2+ and a molecular weight of 481.27 g/mol. Its IUPAC name is [2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-(6-oxo-2-phosphono-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-oxoethyl]-trihydroxyphosphanium.
| Compound Name | [2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-(6-oxo-2-phosphono-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-oxoethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 136634944 |
| Molecular Formula | C14H19N4O11P2+ |
| Molecular Weight | 481.27 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | [2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-(6-oxo-2-phosphono-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-oxoethyl]-trihydroxyphosphanium |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)C[P+](O)(O)O)O[C@H]2n1cnc2c(=O)[nH]c(P(=O)(O)O)nc21 |
| InChI | InChI=1S/C14H18N4O11P2/c1-14(2)28-8-7(5(19)3-30(21,22)23)27-12(9(8)29-14)18-4-15-6-10(18)16-13(17-11(6)20)31(24,25)26/h4,7-9,12,21-23H,3H2,1-2H3,(H2-,16,17,20,24,25,26)/p+1/t7-,8-,9-,12-/m1/s1 |
| InChIKey | MTYMXMZEDXJARN-MFYTUXHUSA-O |
| XLogP | -2.35 |
| TPSA | 226.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.27 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|