C12H17N5O11P2 — CID 135915264
[(4R,6R)-6-(2-amino-6-oxo-1H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] phosphono hydrogen phosphate (PubChem CID 135915264) has the molecular formula C12H17N5O11P2 and a molecular weight of 469.24 g/mol. Its IUPAC name is [(4R,6R)-6-(2-amino-6-oxo-1H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] phosphono hydrogen phosphate.
| Compound Name | [(4R,6R)-6-(2-amino-6-oxo-1H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135915264 |
| Molecular Formula | C12H17N5O11P2 |
| Molecular Weight | 469.24 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | [(4R,6R)-6-(2-amino-6-oxo-1H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] phosphono hydrogen phosphate |
| SMILES | CC1(C)OC2C(O1)[C@H](n1cnc3c(=O)[nH]c(N)nc31)O[C@@H]2OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H17N5O11P2/c1-12(2)25-5-6(26-12)10(27-30(22,23)28-29(19,20)21)24-9(5)17-3-14-4-7(17)15-11(13)16-8(4)18/h3,5-6,9-10H,1-2H3,(H,22,23)(H2,19,20,21)(H3,13,15,16,18)/t5?,6?,9-,10-/m1/s1 |
| InChIKey | BEKJXCVVQPERKE-KAFUYXJBSA-N |
| XLogP | -0.70 |
| TPSA | 230.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|