C22H29N5O8 — CID 137098977
[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2-methylprop-2-enoate (PubChem CID 137098977) has the molecular formula C22H29N5O8 and a molecular weight of 491.50 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 137098977 |
| Molecular Formula | C22H29N5O8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | [(3aR,4R,6R,6aR)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)OC(C)(C)C)nc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H29N5O8/c1-10(2)18(29)31-8-11-13-14(34-22(6,7)33-13)17(32-11)27-9-23-12-15(27)24-19(25-16(12)28)26-20(30)35-21(3,4)5/h9,11,13-14,17H,1,8H2,2-7H3,(H2,24,25,26,28,30)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | HEARMBAEGBAQQW-LSCFUAHRSA-N |
| XLogP | 2.00 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|