C26H33N5O5 — CID 126586611
tert-butyl N-[9-[(3aR,4R,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-benzylpurin-6-yl]carbamate (PubChem CID 126586611) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is tert-butyl N-[9-[(3aR,4R,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-benzylpurin-6-yl]carbamate.
| Compound Name | tert-butyl N-[9-[(3aR,4R,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-benzylpurin-6-yl]carbamate |
|---|---|
| PubChem CID | 126586611 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | tert-butyl N-[9-[(3aR,4R,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-benzylpurin-6-yl]carbamate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(=O)OC(C)(C)C)nc(Cc4ccccc4)nc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C26H33N5O5/c1-7-16-19-20(35-26(5,6)34-19)23(33-16)31-14-27-18-21(30-24(32)36-25(2,3)4)28-17(29-22(18)31)13-15-11-9-8-10-12-15/h8-12,14,16,19-20,23H,7,13H2,1-6H3,(H,28,29,30,32)/t16-,19-,20-,23-/m1/s1 |
| InChIKey | UDXSWUDTLWSJTO-UGTJMOTHSA-N |
| XLogP | 4.59 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |