C20H30N6O7S — CID 165065183
tert-butyl N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[methyl(methylsulfonyl)amino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate (PubChem CID 165065183) has the molecular formula C20H30N6O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is tert-butyl N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[methyl(methylsulfonyl)amino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate.
| Compound Name | tert-butyl N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[methyl(methylsulfonyl)amino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 165065183 |
| Molecular Formula | C20H30N6O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | tert-butyl N-[9-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-[[methyl(methylsulfonyl)amino]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate |
| SMILES | CN(C[C@H]1O[C@@H](n2cnc3c(NC(=O)OC(C)(C)C)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)S(C)(=O)=O |
| InChI | InChI=1S/C20H30N6O7S/c1-19(2,3)33-18(27)24-15-12-16(22-9-21-15)26(10-23-12)17-14-13(31-20(4,5)32-14)11(30-17)8-25(6)34(7,28)29/h9-11,13-14,17H,8H2,1-7H3,(H,21,22,24,27)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | SAOCEACCXUQINS-LSCFUAHRSA-N |
| XLogP | 1.48 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |