C24H32N6O7S — CID 10415110
tert-butyl N-[(1R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-formamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]cyclopent-2-en-1-yl]oxycarbamate (PubChem CID 10415110) has the molecular formula C24H32N6O7S and a molecular weight of 548.62 g/mol. Its IUPAC name is tert-butyl N-[(1R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-formamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]cyclopent-2-en-1-yl]oxycarbamate.
| Compound Name | tert-butyl N-[(1R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-formamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]cyclopent-2-en-1-yl]oxycarbamate |
|---|---|
| PubChem CID | 10415110 |
| Molecular Formula | C24H32N6O7S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | tert-butyl N-[(1R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-formamidopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]cyclopent-2-en-1-yl]oxycarbamate |
| SMILES | CC(C)(C)OC(=O)NO[C@H]1C=C[C@H](SC[C@H]2O[C@@H](n3cnc4c(NC=O)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)C1 |
| InChI | InChI=1S/C24H32N6O7S/c1-23(2,3)36-22(32)29-37-13-6-7-14(8-13)38-9-15-17-18(35-24(4,5)34-17)21(33-15)30-11-27-16-19(28-12-31)25-10-26-20(16)30/h6-7,10-15,17-18,21H,8-9H2,1-5H3,(H,29,32)(H,25,26,28,31)/t13-,14-,15+,17+,18+,21+/m0/s1 |
| InChIKey | BPXLIPPXFCDUPD-WILZBUOQSA-N |
| XLogP | 2.70 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|