C19H27N5O5 — CID 122534103
tert-butyl N-[9-[(3aS,4R,6R)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate (PubChem CID 122534103) has the molecular formula C19H27N5O5 and a molecular weight of 405.46 g/mol. Its IUPAC name is tert-butyl N-[9-[(3aS,4R,6R)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate.
| Compound Name | tert-butyl N-[9-[(3aS,4R,6R)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 122534103 |
| Molecular Formula | C19H27N5O5 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | tert-butyl N-[9-[(3aS,4R,6R)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NC(=O)OC(C)(C)C)ncnc32)[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C19H27N5O5/c1-7-10-12-13(28-19(5,6)27-12)16(26-10)24-9-22-11-14(20-8-21-15(11)24)23-17(25)29-18(2,3)4/h8-10,12-13,16H,7H2,1-6H3,(H,20,21,23,25)/t10-,12?,13+,16-/m1/s1 |
| InChIKey | CXBJMYDLRPTBAN-ZIWBQIBKSA-N |
| XLogP | 3.00 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |