C21H25ClN5O6P — CID 158250380
2-[(3aS,4R,6R)-4-[6-(benzylamino)-2-chloropurin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethylphosphonic acid (PubChem CID 158250380) has the molecular formula C21H25ClN5O6P and a molecular weight of 509.89 g/mol. Its IUPAC name is 2-[(3aS,4R,6R)-4-[6-(benzylamino)-2-chloropurin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethylphosphonic acid.
| Compound Name | 2-[(3aS,4R,6R)-4-[6-(benzylamino)-2-chloropurin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 158250380 |
| Molecular Formula | C21H25ClN5O6P |
| Molecular Weight | 509.89 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-[(3aS,4R,6R)-4-[6-(benzylamino)-2-chloropurin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethylphosphonic acid |
| SMILES | CC1(C)OC2[C@@H](CCP(=O)(O)O)O[C@@H](n3cnc4c(NCc5ccccc5)nc(Cl)nc43)[C@H]2O1 |
| InChI | InChI=1S/C21H25ClN5O6P/c1-21(2)32-15-13(8-9-34(28,29)30)31-19(16(15)33-21)27-11-24-14-17(25-20(22)26-18(14)27)23-10-12-6-4-3-5-7-12/h3-7,11,13,15-16,19H,8-10H2,1-2H3,(H,23,25,26)(H2,28,29,30)/t13-,15?,16+,19-/m1/s1 |
| InChIKey | GGQGFXNMKWFHRT-OMOUFDEYSA-N |
| XLogP | 3.08 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|