C20H21ClN5O7P — CID 146276554
[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146276554) has the molecular formula C20H21ClN5O7P and a molecular weight of 509.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146276554 |
| Molecular Formula | C20H21ClN5O7P |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COCP(=O)(O)O)O[C@@H](n2cnc3c(NCc4ccccc4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C20H21ClN5O7P/c1-2-20(28)13(9-32-11-34(29,30)31)33-18(15(20)27)26-10-23-14-16(24-19(21)25-17(14)26)22-8-12-6-4-3-5-7-12/h1,3-7,10,13,15,18,27-28H,8-9,11H2,(H,22,24,25)(H2,29,30,31)/t13-,15+,18-,20-/m1/s1 |
| InChIKey | HOFUSBLSZAZYIA-UHWHQUHESA-N |
| XLogP | 0.87 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|