C28H27ClN6O6S — CID 146276775
(2R)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 146276775) has the molecular formula C28H27ClN6O6S and a molecular weight of 611.08 g/mol. Its IUPAC name is (2R)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | (2R)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 146276775 |
| Molecular Formula | C28H27ClN6O6S |
| Molecular Weight | 611.08 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | (2R)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopropylmethylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](CO[C@@](Cc2ccccc2)(C(=O)O)c2cscn2)O[C@@H](n2cnc3c(NCC4CC4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C28H27ClN6O6S/c1-2-27(39)19(12-40-28(25(37)38,18-13-42-15-32-18)10-16-6-4-3-5-7-16)41-24(21(27)36)35-14-31-20-22(30-11-17-8-9-17)33-26(29)34-23(20)35/h1,3-7,13-15,17,19,21,24,36,39H,8-12H2,(H,37,38)(H,30,33,34)/t19-,21+,24-,27-,28-/m1/s1 |
| InChIKey | ODCAHPPEEUBNMP-DTSQTJFYSA-N |
| XLogP | 2.62 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.08 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|