C28H24ClN5O8 — CID 146276874
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(4-phenylphenyl)methyl]propanedioic acid (PubChem CID 146276874) has the molecular formula C28H24ClN5O8 and a molecular weight of 593.98 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(4-phenylphenyl)methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(4-phenylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 146276874 |
| Molecular Formula | C28H24ClN5O8 |
| Molecular Weight | 593.98 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[(4-phenylphenyl)methyl]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccc(-c3ccccc3)cc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C28H24ClN5O8/c1-2-27(40)18(42-23(20(27)35)34-14-31-19-21(30)32-26(29)33-22(19)34)13-41-28(24(36)37,25(38)39)12-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h1,3-11,14,18,20,23,35,40H,12-13H2,(H,36,37)(H,38,39)(H2,30,32,33)/t18-,20+,23-,27-/m1/s1 |
| InChIKey | DEGSKQLDUFOSPO-PSXNISQTSA-N |
| XLogP | 1.52 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.98 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|