C24H23N5O9 — CID 146276875
2-[[(2R,3S,4R,5R)-5-(2-acetyl-6-aminopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid (PubChem CID 146276875) has the molecular formula C24H23N5O9 and a molecular weight of 525.47 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(2-acetyl-6-aminopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(2-acetyl-6-aminopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
|---|---|
| PubChem CID | 146276875 |
| Molecular Formula | C24H23N5O9 |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(2-acetyl-6-aminopurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(C(C)=O)nc32)[C@@H]1O |
| InChI | InChI=1S/C24H23N5O9/c1-3-23(36)14(10-37-24(21(32)33,22(34)35)9-13-7-5-4-6-8-13)38-20(16(23)31)29-11-26-15-17(25)27-18(12(2)30)28-19(15)29/h1,4-8,11,14,16,20,31,36H,9-10H2,2H3,(H,32,33)(H,34,35)(H2,25,27,28)/t14-,16+,20-,23-/m1/s1 |
| InChIKey | HMAZMWHYFFOIJL-GIQADNOUSA-N |
| XLogP | -0.60 |
| TPSA | 220.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|