C29H26ClN5O8 — CID 146282665
2-benzyl-2-[[(2R,3S,4R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid (PubChem CID 146282665) has the molecular formula C29H26ClN5O8 and a molecular weight of 608.01 g/mol. Its IUPAC name is 2-benzyl-2-[[(2R,3S,4R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-benzyl-2-[[(2R,3S,4R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 146282665 |
| Molecular Formula | C29H26ClN5O8 |
| Molecular Weight | 608.01 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 2-benzyl-2-[[(2R,3S,4R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)O)OC(n2cnc3c(NCc4ccccc4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C29H26ClN5O8/c1-2-28(41)19(15-42-29(25(37)38,26(39)40)13-17-9-5-3-6-10-17)43-24(21(28)36)35-16-32-20-22(33-27(30)34-23(20)35)31-14-18-11-7-4-8-12-18/h1,3-12,16,19,21,24,36,41H,13-15H2,(H,37,38)(H,39,40)(H,31,33,34)/t19-,21+,24?,28-/m1/s1 |
| InChIKey | AQTYPYCEBYTBRH-XMONCPFZSA-N |
| XLogP | 1.88 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.01 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|