C25H23ClN6O6S — CID 146276822
(2S)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 146276822) has the molecular formula C25H23ClN6O6S and a molecular weight of 571.02 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 146276822 |
| Molecular Formula | C25H23ClN6O6S |
| Molecular Weight | 571.02 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(methylamino)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](CO[C@](Cc2ccccc2)(C(=O)O)c2cscn2)O[C@@H](n2cnc3c(NC)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C25H23ClN6O6S/c1-3-24(36)16(38-21(18(24)33)32-12-28-17-19(27-2)30-23(26)31-20(17)32)10-37-25(22(34)35,15-11-39-13-29-15)9-14-7-5-4-6-8-14/h1,4-8,11-13,16,18,21,33,36H,9-10H2,2H3,(H,34,35)(H,27,30,31)/t16-,18+,21-,24-,25+/m1/s1 |
| InChIKey | CWHHNCFCIIRHGZ-AHUTVFDBSA-N |
| XLogP | 1.84 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.02 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|