C32H31ClN4O7 — CID 158535522
2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopentanoic acid (PubChem CID 158535522) has the molecular formula C32H31ClN4O7 and a molecular weight of 619.07 g/mol. Its IUPAC name is 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopentanoic acid.
| Compound Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopentanoic acid |
|---|---|
| PubChem CID | 158535522 |
| Molecular Formula | C32H31ClN4O7 |
| Molecular Weight | 619.07 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-oxopentanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)CC)O[C@@H](n2cnc3c(CCc4ccccc4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C32H31ClN4O7/c1-3-23(38)32(29(40)41,17-21-13-9-6-10-14-21)43-18-24-31(42,4-2)26(39)28(44-24)37-19-34-25-22(35-30(33)36-27(25)37)16-15-20-11-7-5-8-12-20/h2,5-14,19,24,26,28,39,42H,3,15-18H2,1H3,(H,40,41)/t24-,26+,28-,31-,32?/m1/s1 |
| InChIKey | HNWYFKUBAIVUNM-UZABZIEJSA-N |
| XLogP | 2.95 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|