C30H27ClN4O8 — CID 157103448
carbon dioxide;2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid (PubChem CID 157103448) has the molecular formula C30H27ClN4O8 and a molecular weight of 607.02 g/mol. Its IUPAC name is carbon dioxide;2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid.
| Compound Name | carbon dioxide;2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 157103448 |
| Molecular Formula | C30H27ClN4O8 |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | carbon dioxide;2-[[(2R,3S,4R,5R)-5-[2-chloro-6-(2-phenylethyl)purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)C(=O)O)O[C@@H](n2cnc3c(CCc4ccccc4)nc(Cl)nc32)[C@@H]1O.O=C=O |
| InChI | InChI=1S/C29H27ClN4O6.CO2/c1-2-29(38)22(16-39-21(27(36)37)15-19-11-7-4-8-12-19)40-26(24(29)35)34-17-31-23-20(32-28(30)33-25(23)34)14-13-18-9-5-3-6-10-18;2-1-3/h1,3-12,17,21-22,24,26,35,38H,13-16H2,(H,36,37);/t21?,22-,24+,26-,29-;/m1./s1 |
| InChIKey | AGALHBAWIMMOHG-GOEVBQCRSA-N |
| XLogP | 2.02 |
| TPSA | 173.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|