C15H16ClN5O6 — CID 146282824
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid (PubChem CID 146282824) has the molecular formula C15H16ClN5O6 and a molecular weight of 397.78 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 146282824 |
| Molecular Formula | C15H16ClN5O6 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(C)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C15H16ClN5O6/c1-3-15(25)7(4-26-6(2)13(23)24)27-12(9(15)22)21-5-18-8-10(17)19-14(16)20-11(8)21/h1,5-7,9,12,22,25H,4H2,2H3,(H,23,24)(H2,17,19,20)/t6?,7-,9+,12-,15-/m1/s1 |
| InChIKey | WILDMRBWVGIMGY-QVHWETCASA-N |
| XLogP | -0.83 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|