C28H25ClFN5O6 — CID 162533485
2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid (PubChem CID 162533485) has the molecular formula C28H25ClFN5O6 and a molecular weight of 581.99 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 162533485 |
| Molecular Formula | C28H25ClFN5O6 |
| Molecular Weight | 581.99 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[(3-fluorophenyl)methylamino]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenylpropanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)C(=O)O)O[C@@H](n2cnc3c(NCc4cccc(F)c4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C28H25ClFN5O6/c1-2-28(39)20(14-40-19(26(37)38)12-16-7-4-3-5-8-16)41-25(22(28)36)35-15-32-21-23(33-27(29)34-24(21)35)31-13-17-9-6-10-18(30)11-17/h1,3-11,15,19-20,22,25,36,39H,12-14H2,(H,37,38)(H,31,33,34)/t19?,20-,22+,25-,28-/m1/s1 |
| InChIKey | DDFDCHAFKGPEEO-FQSOMRQASA-N |
| XLogP | 2.57 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.99 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|