C31H25ClFN5O8S — CID 159853749
3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid;carbon dioxide (PubChem CID 159853749) has the molecular formula C31H25ClFN5O8S and a molecular weight of 682.09 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid;carbon dioxide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid;carbon dioxide |
|---|---|
| PubChem CID | 159853749 |
| Molecular Formula | C31H25ClFN5O8S |
| Molecular Weight | 682.09 g/mol |
| Exact Mass | 681.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid;carbon dioxide |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2nc3ccccc3s2)C(=O)O)O[C@@H](n2cnc3c(CCc4ccc(F)cc4)nc(Cl)nc32)[C@@H]1O.O=C=O |
| InChI | InChI=1S/C30H25ClFN5O6S.CO2/c1-2-30(41)22(14-42-20(28(39)40)13-23-34-18-5-3-4-6-21(18)44-23)43-27(25(30)38)37-15-33-24-19(35-29(31)36-26(24)37)12-9-16-7-10-17(32)11-8-16;2-1-3/h1,3-8,10-11,15,20,22,25,27,38,41H,9,12-14H2,(H,39,40);/t20?,22-,25+,27-,30-;/m1./s1 |
| InChIKey | NQGNWMDXGZTDAF-HJBNZXNOSA-N |
| XLogP | 2.77 |
| TPSA | 186.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|