C30H25ClFN5O6S — CID 159853750
3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid (PubChem CID 159853750) has the molecular formula C30H25ClFN5O6S and a molecular weight of 638.08 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 159853750 |
| Molecular Formula | C30H25ClFN5O6S |
| Molecular Weight | 638.08 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-[[(2R,3S,4R,5R)-5-[2-chloro-6-[2-(4-fluorophenyl)ethyl]purin-9-yl]-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanoic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2nc3ccccc3s2)C(=O)O)O[C@@H](n2cnc3c(CCc4ccc(F)cc4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C30H25ClFN5O6S/c1-2-30(41)22(14-42-20(28(39)40)13-23-34-18-5-3-4-6-21(18)44-23)43-27(25(30)38)37-15-33-24-19(35-29(31)36-26(24)37)12-9-16-7-10-17(32)11-8-16/h1,3-8,10-11,15,20,22,25,27,38,41H,9,12-14H2,(H,39,40)/t20?,22-,25+,27-,30-/m1/s1 |
| InChIKey | NVGOXUIABSNGKZ-OMKMSIHJSA-N |
| XLogP | 3.35 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.08 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|