C20H25ClN5O10P — CID 175136721
[1-[[(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 175136721) has the molecular formula C20H25ClN5O10P and a molecular weight of 561.87 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 175136721 |
| Molecular Formula | C20H25ClN5O10P |
| Molecular Weight | 561.87 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(C(=O)OCC)P(=O)(O)O)O[C@@H](n2cnc3c(C4CNCCO4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C20H25ClN5O10P/c1-3-20(29)11(8-35-18(37(30,31)32)17(28)33-4-2)36-16(14(20)27)26-9-23-13-12(10-7-22-5-6-34-10)24-19(21)25-15(13)26/h1,9-11,14,16,18,22,27,29H,4-8H2,2H3,(H2,30,31,32)/t10?,11-,14+,16-,18?,20-/m1/s1 |
| InChIKey | UORKZCGWWORUQO-SMLURGESSA-N |
| XLogP | -1.15 |
| TPSA | 207.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.87 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|