C21H23ClN5O10P — CID 118469422
[(1R)-1-[[(2R,3R,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid (PubChem CID 118469422) has the molecular formula C21H23ClN5O10P and a molecular weight of 571.87 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3R,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3R,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 118469422 |
| Molecular Formula | C21H23ClN5O10P |
| Molecular Weight | 571.87 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | [(1R)-1-[[(2R,3R,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-ethoxy-2-oxoethyl]phosphonic acid |
| SMILES | CCOC(=O)[C@H](OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)nc(Cl)nc32)[C@H](O)[C@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C21H23ClN5O10P/c1-2-35-19(31)20(38(32,33)34)36-8-11-13(28)14(29)18(37-11)27-9-23-12-15(25-21(22)26-16(12)27)24-17(30)10-6-4-3-5-7-10/h3-7,9,11,13-14,18,20,28-29H,2,8H2,1H3,(H2,32,33,34)(H,24,25,26,30)/t11-,13+,14-,18-,20-/m1/s1 |
| InChIKey | NRRPZTMRMFJJPM-BVDDYWJCSA-N |
| XLogP | 0.43 |
| TPSA | 215.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.87 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|