C21H24ClN6O9P — CID 146559687
[1-[[(2R,3S,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(ethylamino)-2-oxoethyl]phosphonic acid (PubChem CID 146559687) has the molecular formula C21H24ClN6O9P and a molecular weight of 570.88 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(ethylamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(ethylamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 146559687 |
| Molecular Formula | C21H24ClN6O9P |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-(6-benzamido-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(ethylamino)-2-oxoethyl]phosphonic acid |
| SMILES | CCNC(=O)C(OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C21H24ClN6O9P/c1-2-23-18(32)20(38(33,34)35)36-8-11-13(29)14(30)19(37-11)28-9-24-12-15(26-21(22)27-16(12)28)25-17(31)10-6-4-3-5-7-10/h3-7,9,11,13-14,19-20,29-30H,2,8H2,1H3,(H,23,32)(H2,33,34,35)(H,25,26,27,31)/t11-,13-,14-,19-,20?/m1/s1 |
| InChIKey | CKWHZEWUDSIDTE-QNAQQMTFSA-N |
| XLogP | 0.01 |
| TPSA | 218.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|