C21H18ClFN6O7S — CID 134326387
2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-benzothiazol-2-ylmethyl)propanedioic acid (PubChem CID 134326387) has the molecular formula C21H18ClFN6O7S and a molecular weight of 552.93 g/mol. Its IUPAC name is 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-benzothiazol-2-ylmethyl)propanedioic acid.
| Compound Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-benzothiazol-2-ylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 134326387 |
| Molecular Formula | C21H18ClFN6O7S |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-benzothiazol-2-ylmethyl)propanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(Cc2nc3ccccc3s2)(C(=O)O)C(=O)O)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C21H18ClFN6O7S/c22-20-27-15(24)13-16(28-20)29(7-25-13)17-12(23)14(30)9(36-17)6-35-21(18(31)32,19(33)34)5-11-26-8-3-1-2-4-10(8)37-11/h1-4,7,9,12,14,17,30H,5-6H2,(H,31,32)(H,33,34)(H2,24,27,28)/t9-,12+,14-,17-/m1/s1 |
| InChIKey | SDJWCPUZBISLAC-XMEITWMYSA-N |
| XLogP | 1.44 |
| TPSA | 195.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|