C16H16ClFN6O5S — CID 167197739
2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 167197739) has the molecular formula C16H16ClFN6O5S and a molecular weight of 458.86 g/mol. Its IUPAC name is 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 167197739 |
| Molecular Formula | C16H16ClFN6O5S |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | CC(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H](F)[C@@H]1O)(C(=O)O)c1cscn1 |
| InChI | InChI=1S/C16H16ClFN6O5S/c1-16(14(26)27,7-3-30-5-21-7)28-2-6-10(25)8(18)13(29-6)24-4-20-9-11(19)22-15(17)23-12(9)24/h3-6,8,10,13,25H,2H2,1H3,(H,26,27)(H2,19,22,23)/t6-,8+,10-,13-,16?/m1/s1 |
| InChIKey | UHKJPOPBBRITNP-XQLCENCOSA-N |
| XLogP | 1.13 |
| TPSA | 158.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |