C28H25ClN6O6S — CID 155415265
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 155415265) has the molecular formula C28H25ClN6O6S and a molecular weight of 609.06 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 155415265 |
| Molecular Formula | C28H25ClN6O6S |
| Molecular Weight | 609.06 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-(4-phenylphenyl)-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(Cc2ccc(-c3ccccc3)cc2)(C(=O)O)c2cscn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H25ClN6O6S/c29-27-33-23(30)20-24(34-27)35(13-31-20)25-22(37)21(36)18(41-25)11-40-28(26(38)39,19-12-42-14-32-19)10-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-9,12-14,18,21-22,25,36-37H,10-11H2,(H,38,39)(H2,30,33,34)/t18-,21-,22-,25-,28?/m1/s1 |
| InChIKey | SDRQDFVCQXLEHU-RJDAIHHJSA-N |
| XLogP | 3.04 |
| TPSA | 178.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.06 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |