C30H29ClN6O8S — CID 155415311
(2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-[4-[2-(hydroxymethyl)-6-methoxyphenyl]phenyl]-2-(1,3-thiazol-4-yl)propanoic acid (PubChem CID 155415311) has the molecular formula C30H29ClN6O8S and a molecular weight of 669.12 g/mol. Its IUPAC name is (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-[4-[2-(hydroxymethyl)-6-methoxyphenyl]phenyl]-2-(1,3-thiazol-4-yl)propanoic acid.
| Compound Name | (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-[4-[2-(hydroxymethyl)-6-methoxyphenyl]phenyl]-2-(1,3-thiazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 155415311 |
| Molecular Formula | C30H29ClN6O8S |
| Molecular Weight | 669.12 g/mol |
| Exact Mass | 668.15 |
| IUPAC Name | (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-[4-[2-(hydroxymethyl)-6-methoxyphenyl]phenyl]-2-(1,3-thiazol-4-yl)propanoic acid |
| SMILES | COc1cccc(CO)c1-c1ccc(C[C@](OC[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@H](O)[C@@H]2O)(C(=O)O)c2cscn2)cc1 |
| InChI | InChI=1S/C30H29ClN6O8S/c1-43-18-4-2-3-17(10-38)21(18)16-7-5-15(6-8-16)9-30(28(41)42,20-12-46-14-34-20)44-11-19-23(39)24(40)27(45-19)37-13-33-22-25(32)35-29(31)36-26(22)37/h2-8,12-14,19,23-24,27,38-40H,9-11H2,1H3,(H,41,42)(H2,32,35,36)/t19-,23-,24-,27-,30-/m1/s1 |
| InChIKey | XMYBATSZKIJONB-PXJASJETSA-N |
| XLogP | 2.54 |
| TPSA | 208.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |