C30H30N6O6S — CID 167626273
(2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2-methyl-1,3-thiazol-4-yl)-3-(4-phenylphenyl)propanoic acid (PubChem CID 167626273) has the molecular formula C30H30N6O6S and a molecular weight of 602.67 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2-methyl-1,3-thiazol-4-yl)-3-(4-phenylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2-methyl-1,3-thiazol-4-yl)-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 167626273 |
| Molecular Formula | C30H30N6O6S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2-methyl-1,3-thiazol-4-yl)-3-(4-phenylphenyl)propanoic acid |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@H](CO[C@](Cc4ccc(-c5ccccc5)cc4)(C(=O)O)c4csc(C)n4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C30H30N6O6S/c1-16-33-26(31)23-27(34-16)36(15-32-23)28-25(38)24(37)21(42-28)13-41-30(29(39)40,22-14-43-17(2)35-22)12-18-8-10-20(11-9-18)19-6-4-3-5-7-19/h3-11,14-15,21,24-25,28,37-38H,12-13H2,1-2H3,(H,39,40)(H2,31,33,34)/t21-,24-,25-,28-,30+/m1/s1 |
| InChIKey | LVLQBSIKBZOXGL-COLIANHNSA-N |
| XLogP | 3.01 |
| TPSA | 178.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |