C22H24N8O6 — CID 167535107
(2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1H-1,2,4-triazol-5-yl)propanoic acid (PubChem CID 167535107) has the molecular formula C22H24N8O6 and a molecular weight of 496.48 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1H-1,2,4-triazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1H-1,2,4-triazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 167535107 |
| Molecular Formula | C22H24N8O6 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(1H-1,2,4-triazol-5-yl)propanoic acid |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@H](CO[C@](Cc4ccccc4)(C(=O)O)c4ncn[nH]4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C22H24N8O6/c1-11-27-17(23)14-18(28-11)30(10-25-14)19-16(32)15(31)13(36-19)8-35-22(21(33)34,20-24-9-26-29-20)7-12-5-3-2-4-6-12/h2-6,9-10,13,15-16,19,31-32H,7-8H2,1H3,(H,33,34)(H2,23,27,28)(H,24,26,29)/t13-,15-,16-,19-,22+/m1/s1 |
| InChIKey | NIGAQUNJHXDTIU-DNSCUGLOSA-N |
| XLogP | -0.31 |
| TPSA | 207.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |