C16H20ClN9O6 — CID 167283856
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)pentanoic acid (PubChem CID 167283856) has the molecular formula C16H20ClN9O6 and a molecular weight of 469.85 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)pentanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 167283856 |
| Molecular Formula | C16H20ClN9O6 |
| Molecular Weight | 469.85 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)pentanoic acid |
| SMILES | CCCC(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@@H]1O)(C(=O)O)c1nn[nH]n1 |
| InChI | InChI=1S/C16H20ClN9O6/c1-2-3-16(14(29)30,13-22-24-25-23-13)31-4-6-8(27)9(28)12(32-6)26-5-19-7-10(18)20-15(17)21-11(7)26/h5-6,8-9,12,27-28H,2-4H2,1H3,(H,29,30)(H2,18,20,21)(H,22,23,24,25)/t6-,8-,9-,12-,16?/m1/s1 |
| InChIKey | HZZJABKBZXICBR-IHZZEADCSA-N |
| XLogP | -1.01 |
| TPSA | 220.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.85 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |