C15H18ClN9O6 — CID 135194282
ethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetate (PubChem CID 135194282) has the molecular formula C15H18ClN9O6 and a molecular weight of 455.82 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetate.
| Compound Name | ethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetate |
|---|---|
| PubChem CID | 135194282 |
| Molecular Formula | C15H18ClN9O6 |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | ethyl 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetate |
| SMILES | CCOC(=O)C(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@@H]1O)c1nn[nH]n1 |
| InChI | InChI=1S/C15H18ClN9O6/c1-2-29-14(28)9(11-21-23-24-22-11)30-3-5-7(26)8(27)13(31-5)25-4-18-6-10(17)19-15(16)20-12(6)25/h4-5,7-9,13,26-27H,2-3H2,1H3,(H2,17,19,20)(H,21,22,23,24)/t5-,7-,8-,9?,13-/m1/s1 |
| InChIKey | PMHBVNWDALYYNV-VKDXYSOPSA-N |
| XLogP | -1.48 |
| TPSA | 209.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |