C16H19ClFN5O6 — CID 134338175
ethyl 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-oxobutanoate (PubChem CID 134338175) has the molecular formula C16H19ClFN5O6 and a molecular weight of 431.81 g/mol. Its IUPAC name is ethyl 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-oxobutanoate.
| Compound Name | ethyl 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-oxobutanoate |
|---|---|
| PubChem CID | 134338175 |
| Molecular Formula | C16H19ClFN5O6 |
| Molecular Weight | 431.81 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | ethyl 2-[[(2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-3-oxobutanoate |
| SMILES | CCOC(=O)C(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H](F)[C@@H]1O)C(C)=O |
| InChI | InChI=1S/C16H19ClFN5O6/c1-3-27-15(26)11(6(2)24)28-4-7-10(25)8(18)14(29-7)23-5-20-9-12(19)21-16(17)22-13(9)23/h5,7-8,10-11,14,25H,3-4H2,1-2H3,(H2,19,21,22)/t7-,8+,10-,11?,14-/m1/s1 |
| InChIKey | XEKMOQACJUDZNR-MXCUAMMDSA-N |
| XLogP | 0.20 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.81 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|