C27H37ClFN5O9 — CID 134338148
ethyl 2-[[(2S,3R,4S,5R)-5-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloropurin-9-yl]-4-fluoro-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate (PubChem CID 134338148) has the molecular formula C27H37ClFN5O9 and a molecular weight of 630.07 g/mol. Its IUPAC name is ethyl 2-[[(2S,3R,4S,5R)-5-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloropurin-9-yl]-4-fluoro-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate.
| Compound Name | ethyl 2-[[(2S,3R,4S,5R)-5-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloropurin-9-yl]-4-fluoro-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate |
|---|---|
| PubChem CID | 134338148 |
| Molecular Formula | C27H37ClFN5O9 |
| Molecular Weight | 630.07 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | ethyl 2-[[(2S,3R,4S,5R)-5-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-chloropurin-9-yl]-4-fluoro-3-methyloxolan-2-yl]methoxy]-3-oxobutanoate |
| SMILES | CCOC(=O)C(OC[C@H]1O[C@@H](n2cnc3c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc(Cl)nc32)[C@@H](F)[C@@H]1C)C(C)=O |
| InChI | InChI=1S/C27H37ClFN5O9/c1-10-39-22(36)18(14(3)35)40-11-15-13(2)16(29)21(41-15)33-12-30-17-19(33)31-23(28)32-20(17)34(24(37)42-26(4,5)6)25(38)43-27(7,8)9/h12-13,15-16,18,21H,10-11H2,1-9H3/t13-,15-,16+,18?,21-/m1/s1 |
| InChIKey | SSSVIJVVBJFAOS-JKADFJKOSA-N |
| XLogP | 4.57 |
| TPSA | 161.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.07 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|