C21H29ClN8O6 — CID 134338156
tert-butyl N-[9-[(2R,3R,4S,5S)-3-azido-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-chloropurin-6-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 134338156) has the molecular formula C21H29ClN8O6 and a molecular weight of 524.97 g/mol. Its IUPAC name is tert-butyl N-[9-[(2R,3R,4S,5S)-3-azido-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-chloropurin-6-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[9-[(2R,3R,4S,5S)-3-azido-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-chloropurin-6-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 134338156 |
| Molecular Formula | C21H29ClN8O6 |
| Molecular Weight | 524.97 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | tert-butyl N-[9-[(2R,3R,4S,5S)-3-azido-5-(hydroxymethyl)-4-methyloxolan-2-yl]-2-chloropurin-6-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | C[C@H]1[C@@H](N=[N+]=[N-])[C@H](n2cnc3c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc(Cl)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C21H29ClN8O6/c1-10-11(8-31)34-16(12(10)27-28-23)29-9-24-13-14(29)25-17(22)26-15(13)30(18(32)35-20(2,3)4)19(33)36-21(5,6)7/h9-12,16,31H,8H2,1-7H3/t10-,11-,12-,16-/m1/s1 |
| InChIKey | BTTLARRLNKDTHA-DSZLRUIBSA-N |
| XLogP | 4.36 |
| TPSA | 177.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.97 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|