About CID 118478703
CID 118478703 (PubChem CID 118478703) has the molecular formula C25H33ClN5O12P
and a molecular weight of 661.99 g/mol.
Molecular Properties
| Compound Name | CID 118478703 |
| PubChem CID | 118478703 |
| Molecular Formula | C25H33ClN5O12P |
| Molecular Weight | 661.99 g/mol |
| Exact Mass | 661.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(C(=O)O)P(=O)=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C25H33ClN5O12P/c1-23(2,3)42-21(34)31(22(35)43-24(4,5)6)16-12-15(28-20(26)29-16)30(10-27-12)17-14-13(40-25(7,8)41-14)11(39-17)9-38-19(18(32)33)44(36)37/h10-11,13-14,17,19H,9H2,1-8H3,(H,32,33)/t11-,13-,14-,17-,19?/m1/s1 |
| InChIKey | LMRBWBLYLMDJKB-BERVYLACSA-N |
| XLogP | 4.17 |
| TPSA | 207.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.99 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 118478703 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118478703?
The IUPAC name of CID 118478703 (CID 118478703) is not available.
What is the SMILES notation for CID 118478703?
The canonical SMILES for CID 118478703 is CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(C(=O)O)P(=O)=O)[C@H]2OC(C)(C)O[C@H]21.
What is the InChIKey of CID 118478703?
The InChIKey is LMRBWBLYLMDJKB-BERVYLACSA-N. The full InChI is InChI=1S/C25H33ClN5O12P/c1-23(2,3)42-21(34)31(22(35)43-24(4,5)6)16-12-15(28-20(26)29-16)30(10-27-12)17-14-13(40-25(7,8)41-14)11(39-17)9-38-19(18(32)33)44(36)37/h10-11,13-14,17,19H,9H2,1-8H3,(H,32,33)/t11-,13-,14-,17-,19?/m1/s1.
What are the key properties of CID 118478703?
CID 118478703 has a molecular weight of 661.99 g/mol, XLogP of 4.17, 7 rotatable bonds, 1 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118478703 is sourced from PubChem (CID 118478703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).