C25H33ClN5O12P — CID 118478703
CID 118478703 (PubChem CID 118478703) has the molecular formula C25H33ClN5O12P and a molecular weight of 661.99 g/mol.
| Compound Name | CID 118478703 |
|---|---|
| PubChem CID | 118478703 |
| Molecular Formula | C25H33ClN5O12P |
| Molecular Weight | 661.99 g/mol |
| Exact Mass | 661.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(C(=O)O)P(=O)=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C25H33ClN5O12P/c1-23(2,3)42-21(34)31(22(35)43-24(4,5)6)16-12-15(28-20(26)29-16)30(10-27-12)17-14-13(40-25(7,8)41-14)11(39-17)9-38-19(18(32)33)44(36)37/h10-11,13-14,17,19H,9H2,1-8H3,(H,32,33)/t11-,13-,14-,17-,19?/m1/s1 |
| InChIKey | LMRBWBLYLMDJKB-BERVYLACSA-N |
| XLogP | 4.17 |
| TPSA | 207.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.99 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|