C19H28ClN6O8P — CID 126569791
[1-[[(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-(2-methylpropylamino)-2-oxoethyl]phosphonic acid (PubChem CID 126569791) has the molecular formula C19H28ClN6O8P and a molecular weight of 534.89 g/mol. Its IUPAC name is [1-[[(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-(2-methylpropylamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[[(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-(2-methylpropylamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 126569791 |
| Molecular Formula | C19H28ClN6O8P |
| Molecular Weight | 534.89 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | [1-[[(3aR,4R,6R,6aR)-4-(6-amino-2-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-2-(2-methylpropylamino)-2-oxoethyl]phosphonic acid |
| SMILES | CC(C)CNC(=O)C(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]2OC(C)(C)O[C@@H]21)P(=O)(O)O |
| InChI | InChI=1S/C19H28ClN6O8P/c1-8(2)5-22-15(27)17(35(28,29)30)31-6-9-11-12(34-19(3,4)33-11)16(32-9)26-7-23-10-13(21)24-18(20)25-14(10)26/h7-9,11-12,16-17H,5-6H2,1-4H3,(H,22,27)(H2,21,24,25)(H2,28,29,30)/t9-,11-,12-,16-,17?/m1/s1 |
| InChIKey | POFOFAJTOBGGSH-NWGCOZEKSA-N |
| XLogP | 0.77 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.89 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|