C13H14ClN9O6 — CID 135156694
(2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetic acid (PubChem CID 135156694) has the molecular formula C13H14ClN9O6 and a molecular weight of 427.77 g/mol. Its IUPAC name is (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetic acid.
| Compound Name | (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 135156694 |
| Molecular Formula | C13H14ClN9O6 |
| Molecular Weight | 427.77 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (2R)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(2H-tetrazol-5-yl)acetic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CO[C@@H](C(=O)O)c2nn[nH]n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H14ClN9O6/c14-13-17-8(15)4-10(18-13)23(2-16-4)11-6(25)5(24)3(29-11)1-28-7(12(26)27)9-19-21-22-20-9/h2-3,5-7,11,24-25H,1H2,(H,26,27)(H2,15,17,18)(H,19,20,21,22)/t3-,5-,6-,7-,11-/m1/s1 |
| InChIKey | JKGNCDKRHCEHJF-ARODIJAPSA-N |
| XLogP | -1.96 |
| TPSA | 220.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.77 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |