C20H20ClN9O6 — CID 135156831
(2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid (PubChem CID 135156831) has the molecular formula C20H20ClN9O6 and a molecular weight of 517.89 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 135156831 |
| Molecular Formula | C20H20ClN9O6 |
| Molecular Weight | 517.89 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-phenyl-2-(2H-tetrazol-5-yl)propanoic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CO[C@](Cc2ccccc2)(C(=O)O)c2nn[nH]n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20ClN9O6/c21-19-24-14(22)11-15(25-19)30(8-23-11)16-13(32)12(31)10(36-16)7-35-20(18(33)34,17-26-28-29-27-17)6-9-4-2-1-3-5-9/h1-5,8,10,12-13,16,31-32H,6-7H2,(H,33,34)(H2,22,24,25)(H,26,27,28,29)/t10-,12-,13-,16-,20+/m1/s1 |
| InChIKey | DEACLKWIYPTCEN-ZJFMMINGSA-N |
| XLogP | -0.57 |
| TPSA | 220.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.89 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |