C23H23ClN6O7 — CID 155415312
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(5-methyl-1,2-oxazol-3-yl)-3-phenylpropanoic acid (PubChem CID 155415312) has the molecular formula C23H23ClN6O7 and a molecular weight of 530.93 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(5-methyl-1,2-oxazol-3-yl)-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(5-methyl-1,2-oxazol-3-yl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 155415312 |
| Molecular Formula | C23H23ClN6O7 |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(5-methyl-1,2-oxazol-3-yl)-3-phenylpropanoic acid |
| SMILES | Cc1cc(C(Cc2ccccc2)(OC[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@H](O)[C@@H]2O)C(=O)O)no1 |
| InChI | InChI=1S/C23H23ClN6O7/c1-11-7-14(29-37-11)23(21(33)34,8-12-5-3-2-4-6-12)35-9-13-16(31)17(32)20(36-13)30-10-26-15-18(25)27-22(24)28-19(15)30/h2-7,10,13,16-17,20,31-32H,8-9H2,1H3,(H,33,34)(H2,25,27,28)/t13-,16-,17-,20-,23?/m1/s1 |
| InChIKey | CEBBCRRINHNXSF-GFYQZYKNSA-N |
| XLogP | 1.22 |
| TPSA | 191.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |