C24H27ClN8O7 — CID 135156721
diethyl 2-[[(2S,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate (PubChem CID 135156721) has the molecular formula C24H27ClN8O7 and a molecular weight of 574.98 g/mol. Its IUPAC name is diethyl 2-[[(2S,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate.
| Compound Name | diethyl 2-[[(2S,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate |
|---|---|
| PubChem CID | 135156721 |
| Molecular Formula | C24H27ClN8O7 |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | diethyl 2-[[(2S,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O)[C@H]1N=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C24H27ClN8O7/c1-3-37-21(35)24(22(36)38-4-2,10-13-8-6-5-7-9-13)39-11-14-15(31-32-27)17(34)20(40-14)33-12-28-16-18(26)29-23(25)30-19(16)33/h5-9,12,14-15,17,20,34H,3-4,10-11H2,1-2H3,(H2,26,29,30)/t14-,15+,17-,20-/m1/s1 |
| InChIKey | RKELIQOEGIPWSA-DOHHPOSVSA-N |
| XLogP | 2.12 |
| TPSA | 209.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|